| Catalog Number |
ACM780698-5 |
| CAS Number |
780-69-8 |
| Structure |
 |
| Description |
Phenyltriethoxysilane may be used in a variety of 1.Mineral Fillers: as a surface modifier for the aluminum trihydrate (ATH) used as a filler in halogen-free flame-retardant (HFFR) cable insulation 2.Silicones: as a crosslinker in high-temperature silicone elastomers 3.Catalysts: as an electron donor. |
| Synonyms |
Tri(ethoxo)(phenyl)silane |
| IUPAC Name |
Triethoxy(phenyl)silane |
| Molecular Weight |
240.37 g/mol |
| Molecular Formula |
C12H20O3Si |
| Canonical SMILES |
CCO[Si](C1=CC=CC=C1)(OCC)OCC |
| InChI |
InChI=1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChI Key |
JCVQKRGIASEUKR-UHFFFAOYSA-N |
| Boiling Point |
112-113/10 |
| Melting Point |
<-50 °C |
| Flash Point |
96°C |
| Purity |
97% |
| Density |
0.996 g/mL |
| Solubility |
Insoluble in water |
| Appearance |
Liquid |
| Application |
Phenyltriethoxysilane, a colorless transparent liquid, is utilized in the creation of self-healing or reusable coatings. |
| Storage |
Inert atmosphere,Room Temperature |
| Autoignition Temperature |
265 |
| Chemical Formula |
C12H20O3Si |
| Complexity |
164 |
| EC Number |
212-305-8 |
| Exact Mass |
240.11817103 |
| Heavy Atom Count |
16 |
| Monoisotopic Mass |
240.11817103 |
| Packaging |
10 g; 100 g |
| Refractive Index |
1.4718 |
| Specific Gravity |
0.99 |
| Topological Polar Surface Area |
27.7 Ų |
| Viscosity |
'1.7 |
| WGK Germany |
3 |
