| Catalog Number | ACM780698-5 |
|---|---|
| CAS Number | 780-69-8 |
| Structure | ![]() |
| Description | Phenyltriethoxysilane may be used in a variety of 1.Mineral Fillers: as a surface modifier for the aluminum trihydrate (ATH) used as a filler in halogen-free flame-retardant (HFFR) cable insulation 2.Silicones: as a crosslinker in high-temperature silicone elastomers 3.Catalysts: as an electron donor. |
| Synonyms | Tri(ethoxo)(phenyl)silane |
| IUPAC Name | Triethoxy(phenyl)silane |
| Molecular Weight | 240.37 g/mol |
| Molecular Formula | C12H20O3Si |
| Canonical SMILES | CCO[Si](C1=CC=CC=C1)(OCC)OCC |
| InChI | InChI=1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChI Key | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| Boiling Point | 112-113/10 |
| Melting Point | <-50 °C |
| Flash Point | 96°C |
| Purity | 97% |
| Density | 0.996 g/mL |
| Solubility | Insoluble in water |
| Appearance | Liquid |
| Application | Phenyltriethoxysilane, a colorless transparent liquid, is utilized in the creation of self-healing or reusable coatings. |
| Storage | Inert atmosphere,Room Temperature |
| Autoignition Temperature | 265 |
| Chemical Formula | C12H20O3Si |
| Complexity | 164 |
| EC Number | 212-305-8 |
| Exact Mass | 240.11817103 |
| Heavy Atom Count | 16 |
| Monoisotopic Mass | 240.11817103 |
| Packaging | 10 g; 100 g |
| Refractive Index | 1.4718 |
| Specific Gravity | 0.99 |
| Topological Polar Surface Area | 27.7 Ų |
| Viscosity | '1.7 |
| WGK Germany | 3 |
※ Please kindly noted that this product is for research use only.