| Catalog Number |
ACM2996921-5 |
| CAS Number |
2996-92-1 |
| Structure |
 |
| Description |
Phenyl-functional silanes can improve the thermal stability of other silanes. Phenyl functional silanes can be used as intermediates for other silanes and siloxanes. Phenyl functional silane can be used for hydrophobic surface treatment. Phenyl functional silanes can be used as hydrophobic additives for other silane coupling agents. |
| Synonyms |
Benzene, (trimethoxysilyl)-, homopolymer |
| IUPAC Name |
Trimethoxy(phenyl)silane |
| Molecular Weight |
198.29 g/mol |
| Molecular Formula |
C9H14O3Si |
| Canonical SMILES |
CO[Si](C1=CC=CC=C1)(OC)OC |
| InChI |
InChI=1S/C9H14O3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChI Key |
ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| Boiling Point |
211 |
| Melting Point |
-25°C |
| Flash Point |
86°C |
| Purity |
97% |
| Density |
1.064 g/mL |
| Appearance |
Colorless liquid |
| Application |
Phenyltrimethoxysilane is a colorless transparent liquid that is utilized in nanoelectronics and material science research. This organosilicate compound serves as a crosslinking agent for silicone resin and is used to create polymer organic silicon compounds. Additionally, trimethoxyphenylsilane (TMPS) can be used as a functional monomer in sol-gel processing and in the production of polytrimethoxyphenylsilane (PTMS) for the removal of graphene after chemical vapor deposition (CVD). TMPS is also essential for the synthesis of molecularly imprinted sol gels for the fabrication of localized surface plasmon resonance (LSPR). |
| Shelf Life |
12 months. |
| Storage |
Keep container tightly closed in a dry and well-ventilated place. Containers which are opened must be carefully resealed and kept upright to prevent leakage. Store in cool place.Moisture sensitive. Recommend |
| Chemical Formula |
C9H14O3Si |
| Complexity |
134 |
| EC Number |
221-066-9 |
| Exact Mass |
198.07122084 |
| Heavy Atom Count |
13 |
| Monoisotopic Mass |
198.07122084 |
| Packaging |
25Kg or 200kg/drum. |
| Refractive Index |
1.4734 |
| Specific Gravity |
1.062-1.072 |
| Topological Polar Surface Area |
27.7 Ų |
| Viscosity |
2.1 |
