| Catalog Number |
ACM17865075 |
| CAS Number |
17865-07-5 |
| Structure |
 |
| Synonyms |
Propyl-Silanetriotriacetate |
| IUPAC Name |
[diacetyloxy(propyl)silyl]acetate |
| Molecular Weight |
248.3 g/mol |
| Molecular Formula |
C3H7Si(OCCH3)3 |
| Canonical SMILES |
CCC[Si](OC(=O)C)(OC(=O)C)OC(=O)C |
| InChI Key |
DKGZKEKMWBGTIB-UHFFFAOYSA-N |
| Boiling Point |
236 °C |
| Flash Point |
80 °C |
| Purity |
0.98 |
| Density |
1.112 g/mL |
| Appearance |
Colorless transparent liquid |
| Application |
Mainly used for rtv-i silicone rubber was silicone rubber, glass (acid) crosslinking agent. Used in silicone sealant (acid) alternative ethyl crosslinking agent, achieve the same use effect. The price is lower than that of ethyl can greatly reduce the production cost. |
| Storage |
In a sealed container, place it in a cool, dry, dark place. After the container is opened, it should be sealed to prevent water vapor from entering the hydrolysis. |
| EC Number |
241-816-9 |
| Exact Mass |
248.07200 |
| Packaging |
Packed with 5L, 20L or 210L plastic/steel drum, 1000L IBC container, or according to customer's requirement. |
