tert-Butoxydiphenylchlorosilane (stabilized with CaCO3)
| Catalog Number | ACM17922246-2 |
|---|---|
| Product Name | tert-Butoxydiphenylchlorosilane (stabilized with CaCO3) |
| CAS | 17922-24-6 |
| Structure |  |
| Synonyms | tert-Butoxychlorodiphenylsilane (stabilized with CaCO3); tert-Butoxydiphenylchlorosilane |
| IUPAC Name | chloro-[(2-methylpropan-2-yl)oxy]-diphenylsilane |
| Molecular Weight | 290.86 |
| Molecular Formula | C16H19ClOSi |
| Canonical SMILES | CC(C)(C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| InChI | InChI=1S/C16H19ClOSi/c1-16(2,3)18-19(17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChI Key | MSZDOMFSWXWKTK-UHFFFAOYSA-N |
| Boiling Point | 112 °C at 0.2 mmHg |
| Flash Point | 56 °C |
| Purity | >95% (GC) |
| Density | 1.076 g/mL at 20 °C (lit.) |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Complexity | 257 |
| Exact Mass | 290.0893695 |
| Formal Charge | 0 |
| Heavy Atom Count | 10 |
| Hydrogen Bond Acceptor Count | 1 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 290.0893695 |
| Rotatable Bond Count | 4 |
| Topological Polar Surface Area | 9.2 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
