| Catalog Number |
ACM17922246-2 |
| CAS Number |
17922-24-6 |
| Structure |
 |
| Synonyms |
tert-Butoxychlorodiphenylsilane (stabilized with CaCO3); tert-Butoxydiphenylchlorosilane |
| IUPAC Name |
chloro-[(2-methylpropan-2-yl)oxy]-diphenylsilane |
| Molecular Weight |
290.86 |
| Molecular Formula |
C16H19ClOSi |
| Canonical SMILES |
CC(C)(C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| InChI |
InChI=1S/C16H19ClOSi/c1-16(2,3)18-19(17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChI Key |
MSZDOMFSWXWKTK-UHFFFAOYSA-N |
| Boiling Point |
112 °C at 0.2 mmHg |
| Flash Point |
56 °C |
| Purity |
>95% (GC) |
| Density |
1.076 g/mL at 20 °C (lit.) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Store under inert gas |
| Complexity |
257 |
| EC Number |
626-967-4 |
| Exact Mass |
290.0893695 |
| Formal Charge |
0 |
| Heavy Atom Count |
10 |
| Hydrogen Bond Acceptor Count |
1 |
| Hydrogen Bond Donor Count |
0 |
| MDL Number |
MFCD00077672 |
| Monoisotopic Mass |
290.0893695 |
| Rotatable Bond Count |
4 |
| Topological Polar Surface Area |
9.2 Ų |
