| Catalog Number |
ACM58479611 |
| CAS Number |
58479-61-1 |
| Structure |
 |
| Description |
It is an important silylation reagent and silicon-based protection agent. |
| Synonyms |
TERT-BUTYLDIPHENYLSILYL CHLORIDE;TERT-BUTYLDIPHENYLCHLOROSILANE;TERT-BUTYLCHLORODIPHENYLSILANE;T-BUTYLCHLORODIPHENYLSILANE;T-BUTYL DIPHENYLCHLOROSILANE;T-BUTYLDIPHENYLSILYL CHLORIDE;TIMTEC-BB SBB009012;butylchlorodiphenylsilane |
| IUPAC Name |
tert-butyl-chloro-diphenylsilane |
| Molecular Weight |
274.86 |
| Molecular Formula |
C16H19ClSi |
| Canonical SMILES |
CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| InChI Key |
MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| Boiling Point |
90°C0.01mm Hg(lit.) |
| Flash Point |
>230°F |
| Purity |
98% min. |
| Density |
1.057g/mL at 25°C(lit.) |
| Appearance |
Oily liquid |
| Application |
It is mainly used as a protective agent to protect alcohols and prepare silicon- based ethers in the synthesis of antibiotics, insecticides, vitamins, etc. It can be used as a silylation reagent and an intermediate in a wide range of organic synthesis. |
| Storage |
Should be stored in a cool, well-ventilated place, and avoid exposure to humidity.
Should be stored in its original containers and used up as soon as possible after opening.
When stored in a strictly sealed and unopened container, it has a shelf life of 12months. |
| EC Number |
261-282-0 |
| Exact Mass |
274.09400 |
| WGK Germany |
3 |
