| Catalog Number | ACM4518983-1 |
|---|---|
| CAS Number | 4518-98-3 |
| Structure | ![]() |
| Synonyms | 1,1,2,2-Tetrachlorodimethyldisilane, 1,2-Dimethyl-1,1,2,2-tetrachlorodisilane, 1,2-Dimethyltetrachlorodisilane, Disilane, 1,1,2,2-tetrachloro-1,2-dimethyl-, sym-Dimethyltetrachlorodisilane |
| IUPAC Name | dichloro-[dichloro(methyl)silyl]-methylsilane |
| Molecular Weight | 228.04 g/mol |
| Molecular Formula | C2H6Cl4Si2 |
| Canonical SMILES | C[Si]([Si](C)(Cl)Cl)(Cl)Cl |
| InChI Key | JTBAMRDUGCDKMS-UHFFFAOYSA-N |
| Boiling Point | 145.7ºC at 760 mmHg |
| Flash Point | 49 °C |
| Purity | >98.0%(T) |
| Density | 1.269 g/mL at 25ºC(lit.) |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Refrigerated (0-10 °C) |
| Chemical Formula | C2H6Cl4Si2 |
| Exact Mass | 225.87600 |
| HS Code | 2931900090 |
| MDL Number | MFCD00192469 |
| Reaxys Registry Number | 2037101 |
※ Please kindly noted that this product is for research use only.