| Catalog Number | ACM3555473-4 |
|---|---|
| CAS Number | 3555-47-3 |
| Synonyms | Tetrakis-trimethylsilyloxy-silan; Tetrakis(trimethylsiloxy)silane; 1,1,1,5,5,5-hexamethyl-3,3-bis-trimethylsilanyloxy-trisiloxane; Tetrakis-trimethylsiloxy-silan; 3.3-Bis-trimethylsiloxy-hexamethyltrisiloxan; Orthokieselsaeure-tetrakis-trimethylsilylester; 1,1,1,5,5,5-Hexamethyl-3,3-bis-trimethylsilyloxy-trisiloxan; |
| IUPAC Name | tetrakis(trimethylsilyl)silicate |
| Molecular Weight | 384.84 g/mol |
| Molecular Formula | C12H36O4Si5 |
| Canonical SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI Key | VNRWTCZXQWOWIG-UHFFFAOYSA-N |
| Boiling Point | 284.4 °C(760 mmHg) |
| Melting Point | -60 °C |
| Flash Point | 117.4 °C |
| Purity | 0.98 |
| Density | 0.893 g/mL |
| Appearance | Transparent liquid |
| Application | Tetrakis(Trimethylsiloxy)Silane is an organosilicon compound primarily used as a precursor in the synthesis of nanostructured organosilicon polymer films through plasma-enhanced chemical vapor deposition (PECVD) at atmospheric pressure Additionally it serves a crucial role in the production of low dielectric constant SiCOH films when used in combination with cyclohexane utilizing the PECVD method |
| Storage | Ambient temperatures. |
| EC Number | 222-613-4 |
| Exact Mass | 384.14600 |
| Packaging | 10 g; 100 g; |
Essential Precursor for SiCOH Film Synthesis
Tetrakis(Trimethylsiloxy)Silane from Alfa Chemistry was crucial in our PECVD experiments. It enabled seamless synthesis of low-k SiCOH films, enhancing our research outcomes significantly. Consistent quality and performance make it indispensable for nanostructured polymer film preparations. Highly recommend!
※ Please kindly noted that this product is for research use only.