| Catalog Number |
ACM4098980-1 |
| CAS Number |
4098-98-0 |
| Structure |
 |
| Synonyms |
1,1,1,3,3,3-Hexamethyl-2,2-bis(trimethylsilyl)trisilane |
| IUPAC Name |
tetrakis(trimethylsilyl)silane |
| Molecular Weight |
320.84 g/mol |
| Molecular Formula |
C12H36Si5 |
| Canonical SMILES |
C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI Key |
BOJSDHZZKKYWAS-UHFFFAOYSA-N |
| Boiling Point |
267ºC |
| Melting Point |
>300°C(lit.) |
| Flash Point |
84.4ºC |
| Purity |
>98.0%(GC) |
| Density |
0.791g/cm³ |
| Appearance |
White to almost white powder to crystaline |
| Storage |
Store at room temperature. |
| Chemical Formula |
C12H36Si5 |
| Condition To Avoid |
Moisture sensitive |
| Exact Mass |
320.16600 |
| MDL Number |
MFCD00054859 |
| Physical State |
Solid |
| Reaxys Registry Number |
1860786 |
