| Catalog Number | ACM17875557-2 |
|---|---|
| CAS Number | 17875-55-7 |
| Structure | ![]() |
| Synonyms | Bis(dimethylsiloxy)diphenylsilane |
| IUPAC Name | [(dimethyl-$l^{3}-silanyl)oxy-diphenylsilyl]oxy-dimethylsilicon |
| Molecular Weight | 332.62 |
| Molecular Formula | C16H24O2Si3 |
| Canonical SMILES | C[Si](C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)C |
| InChI Key | BSXVSQHDSNEHCJ-UHFFFAOYSA-N |
| Boiling Point | 83 °C/4 mmHg |
| Flash Point | 131 °C |
| Purity | >98.0%(GC) |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| HS Code | 2931900090 |
| MDL Number | MFCD00411646 |
| Reaxys Registry Number | 2872840 |
| Specific Gravity | 1 |
※ Please kindly noted that this product is for research use only.