1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane
| Catalog Number |
ACM17875557-2 |
| CAS Number |
17875-55-7 |
| Structure |
 |
| Synonyms |
Bis(dimethylsiloxy)diphenylsilane |
| IUPAC Name |
[(dimethyl-$l^{3}-silanyl)oxy-diphenylsilyl]oxy-dimethylsilicon |
| Molecular Weight |
332.62 |
| Molecular Formula |
C16H24O2Si3 |
| Canonical SMILES |
C[Si](C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)C |
| InChI Key |
BSXVSQHDSNEHCJ-UHFFFAOYSA-N |
| Boiling Point |
83 °C/4 mmHg |
| Flash Point |
131 °C |
| Purity |
>98.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| HS Code |
2931900090 |
| MDL Number |
MFCD00411646 |
| Reaxys Registry Number |
2872840 |
| Specific Gravity |
1 |
※ Please kindly noted that this product is for research use only.
