| Catalog Number |
ACM1048084-1 |
| CAS Number |
1048-08-4 |
| Structure |
 |
| Synonyms |
Nsc33014TetraphenylsiliconBenzene,1,1,1,1-silanetetrayltetrakis-Silane,tetraphenyl- |
| IUPAC Name |
tetraphenylsilane |
| Molecular Weight |
336.51 |
| Molecular Formula |
C24H20Si |
| Canonical SMILES |
C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI Key |
JLAVCPKULITDHO-UHFFFAOYSA-N |
| Boiling Point |
166 °C/0.07 mmHg |
| Melting Point |
238 °C |
| Flash Point |
193ºC |
| Purity |
>97.0%(GC) |
| Density |
mp 236-7 °C g/mL |
| Appearance |
White to almost white powder to crystal |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Condition To Avoid |
Moisture sensitive |
| Exact Mass |
336.13300 |
| MDL Number |
MFCD00014069 |
| Pubchem SID |
87561302 |
| Reaxys Registry Number |
1885911 |
