| Catalog Number | ACM998298 |
|---|---|
| CAS Number | 998-29-8 |
| Structure | ![]() |
| Synonyms | 1-(Dipropylsilyl)propane |
| Molecular Weight | 158.36 g/mol |
| Molecular Formula | C9H22Si |
| Canonical SMILES | CCC[Si](CCC)CCC |
| InChI | InChI=1S/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
| InChI Key | MMYRBBZVCDXGHG-UHFFFAOYSA-N |
| Boiling Point | 171 °C |
| Flash Point | 110 °C |
| Purity | 95% |
| Density | 0.758 g/mLat25°C(lit. |
| Appearance | Colorless Liquid |
| Complexity | 47.5 |
| EC Number | 213-649-1 |
| Exact Mass | 157.141252g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 10 |
| Monoisotopic Mass | 157.141252g/mol |
| Packaging | 10 g; 100 g; |
| Rotatable Bond Count | 6 |
Large inventory
Tri-N-Propylsilane has sufficient inventory and can arrange delivery nearby.
※ Please kindly noted that this product is for research use only.