| Catalog Number | ACM2633570-3 |
|---|---|
| CAS Number | 2633-57-0 |
| Synonyms | Benzene, (Tri-2-Propen-1-Ylsilyl)- |
| IUPAC Name | phenyl-tris(prop-2-enyl)silane |
| Molecular Weight | 228.41 |
| Molecular Formula | C15H20Si |
| Canonical SMILES | C=CC[Si](CC=C)(CC=C)C1=CC=CC=C1 |
| InChI | InChI=1S/C15H20Si/c1-4-12-16(13-5-2,14-6-3)15-10-8-7-9-11-15/h4-11H,1-3,12-14H2 |
| InChI Key | QFCLQSLLAYLBCU-UHFFFAOYSA-N |
| Boiling Point | 275 °C |
| Flash Point | 118 °C |
| Purity | >95.0%(GC) |
| Appearance | Colorless to light yellow clear liquid |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity | 209 |
| Exact Mass | 228.133427g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 16 |
| HS Code | 2931900090 |
| MDL Number | MFCD00094138 |
| Monoisotopic Mass | 228.133427g/mol |
| Reaxys Registry Number | 2830651 |
| Rotatable Bond Count | 7 |
| Specific Gravity | 0.92 |
※ Please kindly noted that this product is for research use only.