| Catalog Number | ACM1990509299-1 |
|---|---|
| CAS Number | 1990509-29-9 |
| Synonyms | Acrylic Acid 3-(Triallylsilyl)propyl Ester (stabilized with MEHQ) |
| IUPAC Name | 3-tris(prop-2-enyl)silylpropyl prop-2-enoate |
| Molecular Weight | 264.44 |
| Molecular Formula | C15H24O2Si |
| Canonical SMILES | C=CC[Si](CCCOC(=O)C=C)(CC=C)CC=C |
| InChI | InChI=1S/C15H24O2Si/c1-5-11-18(12-6-2,13-7-3)14-9-10-17-15(16)8-4/h5-8H,1-4,9-14H2 |
| InChI Key | USYPGKGDLDNTGH-UHFFFAOYSA-N |
| Purity | >92.0%(GC) |
| Appearance | Light yellow to brown clear liquid |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity | 281 |
| Exact Mass | 264.154557g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| HS Code | 2931900090 |
| Monoisotopic Mass | 264.154557g/mol |
| Rotatable Bond Count | 12 |
| Specific Gravity | 0.93 |
※ Please kindly noted that this product is for research use only.