| Catalog Number | ACM78900024-1 |
|---|---|
| CAS Number | 78900-02-4 |
| Synonyms | Benzene,1,2,3,4,5-pentafluoro-6-[3-(trichlorosilyl)propyl]- |
| IUPAC Name | trichloro-[3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
| Molecular Weight | 343.57 |
| Molecular Formula | C9H6Cl3F5Si |
| Canonical SMILES | C(CC1=C(C(=C(C(=C1F)F)F)F)F)C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C9H6Cl3F5Si/c10-18(11,12)3-1-2-4-5(13)7(15)9(17)8(16)6(4)14/h1-3H2 |
| InChI Key | PGOAAUBOHVGLCX-UHFFFAOYSA-N |
| Boiling Point | 99 °C at 0.75 mmHg |
| Melting Point | 27-30 °C |
| Flash Point | 97 °C |
| Purity | >98% (GC) |
| Density | 1.495 g/mL |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Complexity | 261 |
| EC Number | 806-960-4 |
| Exact Mass | 341.922451 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Hydrogen Bond Acceptor Count | 5 |
| Hydrogen Bond Donor Count | 0 |
| MDL Number | MFCD01074474 |
| Monoisotopic Mass | 341.922451 |
| Refractive Index | 1.46 |
| Rotatable Bond Count | 3 |
| Specific Gravity | 1.495 |
| Topological Polar Surface Area | 0 Ų |
※ Please kindly noted that this product is for research use only.