| Catalog Number |
ACM18035331-4 |
| CAS Number |
18035-33-1 |
| Structure |
 |
| Synonyms |
(6-Phenylhexyl)trichlorosilane, Trichloro(6-Phenylhexyl)Silane |
| IUPAC Name |
trichloro(6-phenylhexyl)silane |
| Molecular Weight |
295.7 |
| Molecular Formula |
C12H17Cl3Si |
| Canonical SMILES |
C1=CC=C(C=C1)CCCCCC[Si](Cl)(Cl)Cl |
| InChI |
InChI=1S/C12H17Cl3Si/c13-16(14,15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2 |
| InChI Key |
ODIAUNNUTSSHMI-UHFFFAOYSA-N |
| Boiling Point |
92 °C/0.07 mmHg |
| Flash Point |
162 °C |
| Purity |
>98.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
174 |
| Exact Mass |
294.01651g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
16 |
| HS Code |
2931900090 |
| MDL Number |
MFCD09953885 |
| Monoisotopic Mass |
294.01651g/mol |
| Rotatable Bond Count |
6 |
