| Catalog Number |
ACM13617408-4 |
| CAS Number |
13617-40-8 |
| Structure |
 |
| Synonyms |
(3-Phenylpropyl)trichlorosilane |
| IUPAC Name |
trichloro(3-phenylpropyl)silane |
| Molecular Weight |
253.62 |
| Molecular Formula |
C9H11Cl3Si |
| Canonical SMILES |
C1=CC=C(C=C1)CCC[Si](Cl)(Cl)Cl |
| InChI |
InChI=1S/C9H11Cl3Si/c10-13(11,12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChI Key |
QJOHXSVBLYVERP-UHFFFAOYSA-N |
| Boiling Point |
126 °C/10 mmHg |
| Flash Point |
114 °C |
| Purity |
>97.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
138 |
| Exact Mass |
251.96956g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
13 |
| HS Code |
2931900090 |
| MDL Number |
MFCD09953886 |
| Monoisotopic Mass |
251.96956g/mol |
| Rotatable Bond Count |
3 |
