| Catalog Number |
ACM688359844-2 |
| CAS Number |
688359-84-4 |
| Structure |
 |
| Synonyms |
2-Bromo-2-methylpropionic Acid 3-(Trichlorosilyl)propyl Ester |
| IUPAC Name |
3-trichlorosilylpropyl 2-bromo-2-methylpropanoate |
| Molecular Weight |
342.51 |
| Molecular Formula |
C7H12BrCl3O2Si |
| Canonical SMILES |
CC(C)(C(=O)OCCC[Si](Cl)(Cl)Cl)Br |
| InChI |
InChI=1S/C7H12BrCl3O2Si/c1-7(2,8)6(12)13-4-3-5-14(9,10)11/h3-5H2,1-2H3 |
| InChI Key |
GEVOCWHKMYIZGM-UHFFFAOYSA-N |
| Flash Point |
136 °C |
| Purity |
>95.0%(GC) |
| Density |
1.484±0.06 g/cm³ (Predicted) |
| Appearance |
Colorless to light orange to yellow clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
206 |
| Exact Mass |
339.88555 |
| Formal Charge |
0 |
| Heavy Atom Count |
14 |
| HS Code |
2931900090 |
| Hydrogen Bond Acceptor Count |
2 |
| Hydrogen Bond Donor Count |
0 |
| MDL Number |
MFCD32062941 |
| Monoisotopic Mass |
339.88555 |
| Rotatable Bond Count |
5 |
| Specific Gravity |
1.46 |
| Topological Polar Surface Area |
26.3 Ų |
