| Catalog Number | ACM130676812-1 |
|---|---|
| CAS Number | 130676-81-2 |
| Structure | ![]() |
| Synonyms | Triethoxy[4,4-bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptyl]silane; Silane, triethoxy[5,5,6,6,7,7,7-heptafluoro-4,4-bis(trifluoromethyl)heptyl]- |
| IUPAC Name | triethoxy-[5,5,6,6,7,7,7-heptafluoro-4,4-bis(trifluoromethyl)heptyl]silane |
| Molecular Weight | 524.39 |
| Molecular Formula | C15H21F13O3Si |
| Canonical SMILES | CCO[Si](CCCC(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C15H21F13O3Si/c1-4-29-32(30-5-2,31-6-3)9-7-8-10(13(20,21)22,14(23,24)25)11(16,17)12(18,19)15(26,27)28/h4-9H2,1-3H3 |
| InChI Key | JVAFDQZZUMUFSM-UHFFFAOYSA-N |
| Boiling Point | 81 °C at 1 mmHg |
| Flash Point | 120 °C |
| Purity | >90% (GC) |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Complexity | 556 |
| EC Number | 811-846-2 |
| Exact Mass | 524.1052372 |
| Formal Charge | 0 |
| Heavy Atom Count | 32 |
| Hydrogen Bond Acceptor Count | 16 |
| Hydrogen Bond Donor Count | 0 |
| MDL Number | MFCD27918526 |
| Monoisotopic Mass | 524.1052372 |
| Refractive Index | 1.35 |
| Rotatable Bond Count | 12 |
| Specific Gravity | 1.35 |
| Topological Polar Surface Area | 27.7 Ų |
※ Please kindly noted that this product is for research use only.