| Catalog Number |
ACM780698-4 |
| CAS Number |
780-69-8 |
| Structure |
 |
| Description |
Liquid |
| Synonyms |
Phenyltriethoxysilane, (Triethoxysilyl)benzene, Benzene, (triethoxysilyl)-, Benzeneorthosiliconic acid, triethyl ester |
| IUPAC Name |
triethoxy(phenyl)silane |
| Molecular Weight |
240.37 |
| Molecular Formula |
C12H20O3Si |
| Canonical SMILES |
CCO[Si](C1=CC=CC=C1)(OCC)OCC |
| InChI |
InChI=1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChI Key |
JCVQKRGIASEUKR-UHFFFAOYSA-N |
| Boiling Point |
235 °C |
| Flash Point |
111 °C |
| Purity |
>99.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
164 |
| Exact Mass |
240.118171g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
16 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00009065 |
| Monoisotopic Mass |
240.118171g/mol |
| Reaxys Registry Number |
2940602 |
| Rotatable Bond Count |
7 |
| Specific Gravity |
0.99 |
![Tert-Butyl(((3Ar,4R,6Ar)-5-Fluoro-2,2-Dimethyl-6-((Trityloxy)Methyl)-4,6A-Dihydro-3Ah-Cyclopenta[D][1,3]Dioxol-4-Yl)Oxy)Diphenylsilane](https://resource.alfa-chemistry.com/structure/805245-41-4.gif)
