| Catalog Number | ACM5577720-1 |
|---|---|
| CAS Number | 5577-72-0 |
| Synonyms | Methacrylic Acid (Triethoxysilyl)Methyl Ester (Stabilized With Mehq) |
| IUPAC Name | triethoxysilylmethyl 2-methylprop-2-enoate |
| Molecular Weight | 262.38 |
| Molecular Formula | C11H22O5Si |
| Canonical SMILES | CCO[Si](COC(=O)C(=C)C)(OCC)OCC |
| InChI | InChI=1S/C11H22O5Si/c1-6-14-17(15-7-2,16-8-3)9-13-11(12)10(4)5/h4,6-9H2,1-3,5H3 |
| InChI Key | UZIAQVMNAXPCJQ-UHFFFAOYSA-N |
| Boiling Point | 97 °C (3.5 mmHg) |
| Flash Point | 90 °C |
| Purity | >97% |
| Appearance | Colorless to Almost colorless clear liquid |
| Complexity | 237 |
| Exact Mass | 262.12365g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| MDL Number | MFCD00156470 |
| Monoisotopic Mass | 262.12365g/mol |
| Reaxys Registry Number | 1791293 |
| Rotatable Bond Count | 10 |
| Specific Gravity | 1 |
※ Please kindly noted that this product is for research use only.