| Catalog Number |
ACM5577720-1 |
| CAS Number |
5577-72-0 |
| Structure |
 |
| Synonyms |
Methacrylic Acid (Triethoxysilyl)Methyl Ester (Stabilized With Mehq) |
| IUPAC Name |
triethoxysilylmethyl 2-methylprop-2-enoate |
| Molecular Weight |
262.38 |
| Molecular Formula |
C11H22O5Si |
| Canonical SMILES |
CCO[Si](COC(=O)C(=C)C)(OCC)OCC |
| InChI |
InChI=1S/C11H22O5Si/c1-6-14-17(15-7-2,16-8-3)9-13-11(12)10(4)5/h4,6-9H2,1-3,5H3 |
| InChI Key |
UZIAQVMNAXPCJQ-UHFFFAOYSA-N |
| Boiling Point |
97 °C (3.5 mmHg) |
| Flash Point |
90 °C |
| Purity |
>97% |
| Appearance |
Colorless to Almost colorless clear liquid |
| Complexity |
237 |
| Exact Mass |
262.12365g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
17 |
| MDL Number |
MFCD00156470 |
| Monoisotopic Mass |
262.12365g/mol |
| Reaxys Registry Number |
1791293 |
| Rotatable Bond Count |
10 |
| Specific Gravity |
1 |
