| Catalog Number |
ACM223668642-4 |
| CAS Number |
223668-64-2 |
| Structure |
 |
| Synonyms |
1,2,3,4,5-Pentafluoro-6-(trimethoxysilyl)benzene, Benzene, 1,2,3,4,5-Pentafluoro-6-(Trimethoxysilyl)-, Pentafluorophenyltrimethoxysilane, Silane, trimethoxy(pentafluorophenyl)- |
| IUPAC Name |
trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| Molecular Weight |
288.25 |
| Molecular Formula |
C9H9F5O3Si |
| Canonical SMILES |
CO[Si](C1=C(C(=C(C(=C1F)F)F)F)F)(OC)OC |
| InChI |
InChI=1S/C9H9F5O3Si/c1-15-18(16-2,17-3)9-7(13)5(11)4(10)6(12)8(9)14/h1-3H3 |
| InChI Key |
XFFHTZIRHGKTBQ-UHFFFAOYSA-N |
| Flash Point |
65 °C |
| Purity |
>97.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
257 |
| Exact Mass |
288.024112g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
18 |
| HS Code |
2931900090 |
| MDL Number |
MFCD04039205 |
| Monoisotopic Mass |
288.024112g/mol |
| Rotatable Bond Count |
4 |
