| Catalog Number |
ACM3068766-9 |
| CAS Number |
3068-76-6 |
| Structure |
 |
| Description |
Liquid |
| Synonyms |
N-[3-(Trimethoxysilyl)propyl]aniline, (3-Anilinopropyl)trimethoxysilane, (N-Phenyl-γ-aminopropyl)trimethoxysilane, (γ-Anilinopropyl)trimethoxysilane, 3-(N-Phenylaminopropyl)trimethoxysilane, 3-(Phenylaminopropyl)trimethoxysilane[(Phenylamino)propyl]trimethoxysilane, |
| IUPAC Name |
N-(3-trimethoxysilylpropyl)aniline |
| Molecular Weight |
255.39 |
| Molecular Formula |
C12H21NO3Si |
| Canonical SMILES |
CO[Si](CCCNC1=CC=CC=C1)(OC)OC |
| InChI |
InChI=1S/C12H21NO3Si/c1-14-17(15-2,16-3)11-7-10-13-12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3 |
| InChI Key |
KBJFYLLAMSZSOG-UHFFFAOYSA-N |
| Boiling Point |
310 °C |
| Flash Point |
165 °C |
| Purity |
>98.0%(T) |
| Appearance |
Colorless to light yellow to light orange clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
186 |
| Exact Mass |
255.12907g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
17 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00053673 |
| Monoisotopic Mass |
255.12907g/mol |
| Reaxys Registry Number |
8620045 |
| Rotatable Bond Count |
8 |
| Specific Gravity |
1.07 |
