| Catalog Number |
ACM2996921-4 |
| CAS Number |
2996-92-1 |
| Structure |
 |
| Description |
Liquid |
| Synonyms |
(Trimethoxysilyl)benzene; Phenyltrimethoxysilane |
| IUPAC Name |
trimethoxy(phenyl)silane |
| Molecular Weight |
198.29 g/mol |
| Molecular Formula |
C9H14O3Si |
| Canonical SMILES |
CO[Si](C1=CC=CC=C1)(OC)OC |
| InChI |
InChI=1S/C9H14O3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChI Key |
ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| Boiling Point |
131 °C/45 mmHg |
| Melting Point |
-25 °C |
| Flash Point |
94 °C |
| Purity |
>98.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Application |
Trimethoxyphenylsilane is an organosilicate compound for nanoelectronics and material science research |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Chemical Formula |
C9H14SiO3 |
| Complexity |
134 |
| Exact Mass |
198.071221g/mol |
| Formal Charge |
0 |
| Hazardous Materials Information |
This product is subject to an additional Dangerous Goods shipping charge. |
| Heavy Atom Count |
13 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00025689 |
| Monoisotopic Mass |
198.071221g/mol |
| Reaxys Registry Number |
2937896 |
| Rotatable Bond Count |
4 |
| Specific Gravity |
1.07 |
