| Catalog Number | ACM18052761-4 |
|---|---|
| CAS Number | 18052-76-1 |
| Structure | ![]() |
| Synonyms | Trimethoxy(1-naphthyl)silane, Trimethoxy(Naphthalen-1-Yl)Silane |
| IUPAC Name | trimethoxy(naphthalen-1-yl)silane |
| Molecular Weight | 248.35 |
| Molecular Formula | C13H16O3Si |
| Canonical SMILES | CO[Si](C1=CC=CC2=CC=CC=C21)(OC)OC |
| InChI | InChI=1S/C13H16O3Si/c1-14-17(15-2,16-3)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,1-3H3 |
| InChI Key | ZSOVVFMGSCDMIF-UHFFFAOYSA-N |
| Boiling Point | 148 °C/9 mmHg |
| Melting Point | 39 °C |
| Flash Point | 128 °C |
| Purity | >98.0%(GC) |
| Solubility | Soluble in methanol |
| Appearance | White to almost white powder to lump |
| Storage | Refrigerated (0-10 °C) |
| Complexity | 235 |
| Exact Mass | 248.086871g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 17 |
| HS Code | 2931900090 |
| MDL Number | MFCD00094090 |
| Monoisotopic Mass | 248.086871g/mol |
| Reaxys Registry Number | 2849142 |
| Rotatable Bond Count | 4 |
※ Please kindly noted that this product is for research use only.