| Catalog Number |
ACM4369146-10 |
| CAS Number |
4369-14-6 |
| Structure |
 |
| Description |
3-(Trimethoxysilyl)propyl acrylate is a reactive monomer that is majorly used as a silane coupling agent for the formation of hybrid compounds. It facilitates the formation of a hydrophobic surface by lowering the surface tension and increasing the wettability. |
| Synonyms |
(3-Acryloyloxypropyl)trimethoxysilane |
| IUPAC Name |
3-trimethoxysilylpropyl prop-2-enoate |
| Molecular Weight |
234.32 |
| Molecular Formula |
H2C=CHCO2(CH2)3Si(OCH3)3 |
| Canonical SMILES |
CO[Si](CCCOC(=O)C=C)(OC)OC |
| InChI |
1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChI Key |
KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| Boiling Point |
68 °C at 0.4 mmHg (lit.) |
| Purity |
≥97% |
| Density |
1.055 g/mL at 25 °C (lit.) |
| Application |
3-(Trimethoxysilyl)propyl acrylate is a colorless transparent liquid that is primarily used as a silane coupling agent to enhance the thermal conductivity of silicone rubber filled with hybrid fillers. It plays a crucial role in the synthesis of vinyl and acryalte modified silica nanoparticles and is involved in the modification of fluorescein isothiocyanate-mesoporous silica nanoparticles with carbon-carbon double bonds. This reactive monomer facilitates the formation of hybrid compounds by creating a hydrophobic surface, reducing surface tension, and increasing wettability. |
| Storage |
Inert atmosphere |
| Complexity |
194 |
| EC Number |
419-560-6;610-134-7 |
| Exact Mass |
234.09235g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
15 |
| MDL Number |
MFCD00054803 |
| Monoisotopic Mass |
234.09235g/mol |
| Packaging |
Packaging
5 mL in glass bottle
25 mL in poly bottle |
| Refractive Index |
n20/D 1.429 (lit.) |
| Rotatable Bond Count |
9 |
