3-(Trimethoxysilyl)propyl acrylate
| Catalog Number | ACM4369146-10 |
|---|---|
| Product Name | 3-(Trimethoxysilyl)propyl acrylate |
| CAS | 4369-14-6 |
| Structure |  |
| Description | 3-(Trimethoxysilyl)propyl acrylate is a reactive monomer that is majorly used as a silane coupling agent for the formation of hybrid compounds. It facilitates the formation of a hydrophobic surface by lowering the surface tension and increasing the wettability. |
| Synonyms | (3-Acryloyloxypropyl)trimethoxysilane |
| IUPAC Name | 3-trimethoxysilylpropyl prop-2-enoate |
| Molecular Weight | 234.32 |
| Molecular Formula | H2C=CHCO2(CH2)3Si(OCH3)3 |
| Canonical SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
| InChI | 1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChI Key | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| Boiling Point | 68 °C at 0.4 mmHg (lit.) |
| Purity | ≥97% |
| Density | 1.055 g/mL at 25 °C (lit.) |
| Application | This product is suitable for scientific research. |
| Storage | Inert atmosphere |
| Complexity | 194 |
| Exact Mass | 234.09235g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 15 |
| Monoisotopic Mass | 234.09235g/mol |
| Refractive Index | n20/D 1.429 (lit.) |
| Rotatable Bond Count | 9 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
![Trimethoxy[3-(Methylamino)Propyl]Silane](https://resource.alfa-chemistry.com/structure/3069-25-8.gif)
![[3-(Diethylamino)Propyl]Trimethoxysilane](https://resource.alfa-chemistry.com/structure/41051-80-3.gif)
![Bis[3-(Trimethoxysilyl)Propyl]Amine](https://resource.alfa-chemistry.com/structure/82985-35-1.gif)
