| Catalog Number |
ACM4369146-11 |
| CAS Number |
4369-14-6 |
| Structure |
 |
| Synonyms |
Acrylic Acid 3-(Trimethoxysilyl)propyl Ester (stabilized with BHT), 3-(Acryloyloxy)propyltrimethoxysilane (stabilized with BHT), (3-Acryloxypropyl)trimethoxysilane, 1-Propanol, 3-(trimethoxysilyl)-, acrylate, 2-Propenoic acid, 3-(trimethoxysilyl)propyl ester, 3-(Trimethoxysilyl)Propyl Prop-2-Enoate, 3-(Trimethoxysilyl)propyl 2-propenoate, 3-(Trimethoxysilyl)propyl acrylate, 3-Acryloxypropyltrimethoxysilane, 3-Trimethoxysilylpropyl prop-2-enoate |
| IUPAC Name |
3-trimethoxysilylpropyl prop-2-enoate |
| Molecular Weight |
234.32 |
| Molecular Formula |
C9H18O5Si |
| Canonical SMILES |
CO[Si](CCCOC(=O)C=C)(OC)OC |
| InChI |
InChI=1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChI Key |
KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| Boiling Point |
95 °C/3 mmHg |
| Flash Point |
123 °C |
| Purity |
>93.0%(GC) |
| Appearance |
Colorless to almost colorless clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
194 |
| Exact Mass |
234.09235g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
15 |
| HS Code |
2916120090 |
| MDL Number |
MFCD00054803 |
| Monoisotopic Mass |
234.09235g/mol |
| Reaxys Registry Number |
2046320 |
| Rotatable Bond Count |
9 |
| Specific Gravity |
1.06 |
