| Catalog Number |
ACM1067534 |
| CAS Number |
1067-53-4 |
| Structure |
 |
| Synonyms |
(tris(beta-methoxyethoxy))vinylsilane;[Tris(p-methoxyethoxy)]vinylsilane;2,5,7,10-Tetraoxa-6-silaundecane,6-ethenyl-6-(2-methoxyethoxy)-;5,7,10-Tetraoxa-6-silaundecane,6-ethenyl-6-(2-methoxyethoxy)-2;6-(2-Methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaund |
| IUPAC Name |
ethenyl-tris(2-methoxyethoxy)silane |
| Molecular Weight |
280.39 g/mol |
| Molecular Formula |
C11H24O6Si |
| Canonical SMILES |
COCCO[Si](C=C)(OCCOC)OCCOC |
| InChI Key |
WOXXJEVNDJOOLV-UHFFFAOYSA-N |
| Boiling Point |
289.5 °C(760 mmHg) |
| Melting Point |
-30ºC |
| Flash Point |
198°F |
| Purity |
95%+ |
| Density |
1.040 (25°C) |
| Appearance |
Transparent liquid |
| Application |
Tris(2-Methoxyethoxy)(Vinyl)Silane serves as a versatile vinyl-functional coupling agent designed to enhance the adhesion between unsaturated, polyester-type resins or crosslinked polyethylene resins and elastomers with inorganic substrates, including fiberglass, silica, silicates, and various metal oxides. This colorless, transparent liquid improves the mechanical and electrical stability of products, particularly their resilience to heat and moisture. Its primary applications include functioning as an effective adhesion promoter for mineral-filled polymers, ensuring superior mechanical and electrical properties even in moist conditions. Additionally, it acts as a co-monomer in the synthesis of polymers like polyethylene and acrylics, leading to enhanced adhesion to inorganic surfaces and enabling moisture-induced crosslinking. By augmenting filler compatibility with polymers, it aids in achieving better dispersibility, reducing melt viscosity, and facilitating easier processing of filled plastics. Moreover, it is employed in the pre-treatment of glass, metal, or ceramic surfaces to enhance coating adhesion and improve corrosion resistance. |
| Storage |
Sealed in dry,2-8 °C |
| EC Number |
213-934-0 |
| Exact Mass |
280.13400 |
| MDL Number |
MFCD00008500 |
| Viscosity |
1-2cs (25°C) |
| WGK Germany |
1 |
