| Catalog Number |
ACM1873898-3 |
| CAS Number |
1873-89-8 |
| Structure |
 |
| Synonyms |
Tris(trimethylsiloxy)silane; 2.2.6.6-tetramethyl-4-trimethylsiloxy-2,4,6-trisila-3.5-dioxaheptane; EINECS 217-497-7; 3-Hydrogen-1,1,1,5,5,5-hexamethyl-3-trimethylsiloxytrisiloxan; Tris(trimethylsilyloxy)silane; |
| IUPAC Name |
tris(trimethylsilyloxy)silicon |
| Molecular Weight |
296.66 g/mol |
| Molecular Formula |
C9H28O3Si4 |
| Canonical SMILES |
C[Si](C)(C)O[Si](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI Key |
XAASNKQYFKTYTR-UHFFFAOYSA-N |
| Boiling Point |
185°C(lit.) |
| Flash Point |
55ºC |
| Purity |
97% |
| Density |
0.852 g/mL at 25°C (lit.) |
| Appearance |
Transparent liquid |
| Application |
Tris(trimethylsiloxy)silane is a silicon containing compound |
| Storage |
Store at room temperature. |
| Chemical Formula |
C9H28O3Si4 |
| EC Number |
217-497-7 |
| Exact Mass |
296.11200 |
| Hazardous Materials Information |
This is classified as a Dangerous Good for transport and may be subject to additional shipping charges. |
| MDL Number |
MFCD00054865 |
| Packaging |
10 g; 100 g; |
| Physical State |
Liquid |
| Refractive Index |
n20/D 1.3865 |
