| Catalog Number | ACM1067534-8 |
|---|---|
| CAS Number | 1067-53-4 |
| Structure | ![]() |
| Description | It is a vinyl functional silane coupling agent which can improve adhesion on various organic polymers. |
| Synonyms | Tris(2-methoxyethoxy)vinylsilane, 6-Ethenyl-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
| IUPAC Name | ethenyl-tris(2-methoxyethoxy)silane |
| Molecular Weight | 280.39 g/mol |
| Molecular Formula | C11H24O6Si |
| Canonical SMILES | COCCO[Si](C=C)(OCCOC)OCCOC |
| InChI | InChI=1S/C11H24O6Si/c1-5-18(15-9-6-12-2,16-10-7-13-3)17-11-8-14-4/h5H,1,6-11H2,2-4H3 |
| InChI Key | WOXXJEVNDJOOLV-UHFFFAOYSA-N |
| Boiling Point | 284-286 |
| Melting Point | -30 °C |
| Flash Point | 115°C |
| Purity | 97% |
| Density | 1.0336 g/mL |
| Appearance | Colorless to almost colorless clear liquid |
| Application | It can be used to improve adhesion between various organic polymers and inorganic materials such as silica, silicates and fiber glass. |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Autoignition Temperature | 210 |
| Chemical Formula | C11H24O6Si |
| Complexity | 175 |
| EC Number | 213-934-0 |
| Exact Mass | 280.134215g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| HS Code | 2931900090 |
| MDL Number | MFCD00008500 |
| Monoisotopic Mass | 280.134215g/mol |
| Reaxys Registry Number | 1795316 |
| Refractive Index | 1.4271 |
| Rotatable Bond Count | 13 |
| Specific Gravity | 1.04 |
※ Please kindly noted that this product is for research use only.