| Catalog Number |
ACM1067534-8 |
| CAS Number |
1067-53-4 |
| Structure |
 |
| Description |
It is a vinyl functional silane coupling agent which can improve adhesion on various organic polymers. |
| Synonyms |
Tris(2-methoxyethoxy)vinylsilane, 6-Ethenyl-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
| IUPAC Name |
ethenyl-tris(2-methoxyethoxy)silane |
| Molecular Weight |
280.39 g/mol |
| Molecular Formula |
C11H24O6Si |
| Canonical SMILES |
COCCO[Si](C=C)(OCCOC)OCCOC |
| InChI |
InChI=1S/C11H24O6Si/c1-5-18(15-9-6-12-2,16-10-7-13-3)17-11-8-14-4/h5H,1,6-11H2,2-4H3 |
| InChI Key |
WOXXJEVNDJOOLV-UHFFFAOYSA-N |
| Boiling Point |
284-286 |
| Melting Point |
-30 °C |
| Flash Point |
115°C |
| Purity |
97% |
| Density |
1.0336 g/mL |
| Appearance |
Colorless to almost colorless clear liquid |
| Application |
It can be used to improve adhesion between various organic polymers and inorganic materials such as silica, silicates and fiber glass. |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Autoignition Temperature |
210 |
| Chemical Formula |
C11H24O6Si |
| Complexity |
175 |
| EC Number |
213-934-0 |
| Exact Mass |
280.134215g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
18 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00008500 |
| Monoisotopic Mass |
280.134215g/mol |
| Reaxys Registry Number |
1795316 |
| Refractive Index |
1.4271 |
| Rotatable Bond Count |
13 |
| Specific Gravity |
1.04 |
