| Catalog Number | ACM5931179 |
|---|---|
| CAS Number | 5931-17-9 |
| Structure | ![]() |
| Synonyms | 4-[[4-hydroxybutyl(dimethyl)silyl]oxy-dimethylsilyl]butan-1-ol; |
| IUPAC Name | 4-[[4-hydroxybutyl(dimethyl)silyl]oxy-dimethylsilyl]butan-1-ol |
| Molecular Weight | 278.54 g/mol |
| Molecular Formula | C12H30O3Si2 |
| Canonical SMILES | C[Si](C)(CCCCO)O[Si](C)(C)CCCCO |
| InChI Key | OWJKJLOCIDNNGJ-UHFFFAOYSA-N |
| Boiling Point | 148 °C |
| Melting Point | <0 °C |
| Flash Point | 110 °C |
| Purity | >96% |
| Density | 0.93 g/mL |
| Appearance | Colorless to almost colorless clear liquid |
| EC Number | 611-816-7 |
| Exact Mass | 278.17300 |
| MDL Number | MFCD00039554 |
| Packaging | 10 g; 100 g; |
| Reaxys Registry Number | 1767695 |
| Refractive Index | 1.4526 [25ºC] |
| Specific Gravity | 0.94 |
※ Please kindly noted that this product is for research use only.