1,3-Divinyltetramethyldisiloxane
| Catalog Number | ACM2627954-4 |
|---|---|
| Product Name | 1,3-Divinyltetramethyldisiloxane |
| CAS | 2627-95-4 |
| Structure |  |
| Description | Liquid |
| Synonyms | 1,1,3,3-Tetramethyl-1,3-divinyldisiloxane |
| IUPAC Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
| Molecular Weight | 186.40 |
| Molecular Formula | [H2C=CHSi(CH3)2]2O |
| Canonical SMILES | C[Si](C)(O[Si](C)(C)C=C)C=C |
| InChI | 1S/C8H18OSi2/c1-7-10(3,4)9-11(5,6)8-2/h7-8H,1-2H2,3-6H3 |
| InChI Key | BITPLIXHRASDQB-UHFFFAOYSA-N |
| Boiling Point | 139 °C (lit.) |
| Melting Point | −99 °C (lit.) |
| Flash Point | 19 °C |
| Purity | ≥ 97% |
| Density | 0.809 g/mL at 25 °C (lit.) |
| Solubility | Insoluble in water.Soluble in Methanol. |
| Appearance | Colorless to almost colorless clear liquid |
| Application | This product is suitable for scientific research. |
| Storage | Moisture Sensitive |
| Complexity | 144 |
| Exact Mass | 186.089618g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 11 |
| Monoisotopic Mass | 186.089618g/mol |
| Refractive Index | n20/D 1.411 (lit.) |
| Rotatable Bond Count | 4 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
