(1E)-1-Tert-Butoxy-1-(Trimethylsilyloxy)Propene
| Catalog Number | ACM72658107 |
|---|---|
| Product Name | (1E)-1-Tert-Butoxy-1-(Trimethylsilyloxy)Propene |
| CAS | 72658-10-7 |
| Structure |  |
| Synonyms | {[(1E)-1-Tert-Butoxyprop-1-En-1-Yl]Oxy}(Trimethyl)Silane |
| IUPAC Name | trimethyl-[1-[(2-methylpropan-2-yl)oxy]prop-1-enoxy]silane |
| Molecular Weight | 202.37 g/mol |
| Molecular Formula | C10H22O2Si |
| Canonical SMILES | CC=C(OC(C)(C)C)O[Si](C)(C)C |
| InChI Key | OJYHIAHTMZIVKY-UHFFFAOYSA-N |
| Boiling Point | 53 °C(5.6 mmHg) |
| Flash Point | 57 °C |
| Purity | >92% |
| Density | 0.859g/cm³ |
| Appearance | Colorless to Almost colorless clear liquid |
| Storage | 0-10 °CStore under inert gas |
| Exact Mass | 202.13900 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
![5-Bromo-3-Iodo-1-Triisopropylsilanyl-1H-Pyrrolo[2,3-B]Pyridine](https://resource.alfa-chemistry.com/structure/875639-49-9.gif)
