1H,1H,2H,2H-Perfluorodecyltriethoxysilane
| Catalog Number | ACM101947164-7 |
|---|---|
| Product Name | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane |
| CAS | 101947-16-4 |
| Structure |  |
| Description | 97% |
| Synonyms | Triethoxy-1H,1H,2H,2H-heptadecafluorodecylsilane |
| IUPAC Name | Triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
| Molecular Weight | 610.38 |
| Molecular Formula | C16H19F17O3Si |
| Canonical SMILES | CCO[Si](CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C16H19F17O3Si/c1-4-34-37(35-5-2,36-6-3)8-7-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h4-8H2,1-3H3 |
| InChI Key | MLXDKRSDUJLNAB-UHFFFAOYSA-N |
| Boiling Point | 209-230 °C |
| Flash Point | >230 °F |
| Purity | 95%+ |
| Density | 1.389 g/mL at 25 °C (lit.) |
| Solubility | Miscible with ethanol and tetrahydrofuran |
| Appearance | Colourless liquid |
| Storage | Under inert gas (nitrogen or Argon) at 2-8 °C |
| Complexity | 736 |
| Exact Mass | 610.0831998 |
| Formal Charge | 0 |
| Heavy Atom Count | 37 |
| Monoisotopic Mass | 610.0831998 |
| Refractive Index | 1.342 |
| Rotatable Bond Count | 15 |
| Topological Polar Surface Area | 27.7 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
