| Catalog Number | ACM83048651-7 |
|---|---|
| CAS Number | 83048-65-1 |
| Structure | ![]() |
| Synonyms | (1H,1H,2H,2H-Heptadecafluorodec-1-yl)(trimethoxy)silane |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(trimethoxy)silane; |
| Molecular Weight | 568.30 g/mol |
| Molecular Formula | C13H13F17O3Si |
| Canonical SMILES | CO[Si](CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OC)OC |
| InChI | InChI=1S/C13H13F17O3Si/c1-31-34(32-2,33-3)5-4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h4-5H2,1-3H3; |
| InChI Key | HJIMAFKWSKZMBK-UHFFFAOYSA-N; |
| Boiling Point | 250 °C (760 mmHg) |
| Flash Point | 105 °C |
| Purity | ≥97% |
| Density | 1.453 g/mL |
| Appearance | Colorless liquid |
| Application | 1H,1H,2H,2H-Perfluorodecyltrimethoxysilane is a silicon-based monomer with various applications. It is commonly used as an anti-fingerprint agent and coating material for advanced glass products such as mobile phone screens and camera lenses. Additionally, it is utilized in the preparation of abrasion-resistant super-antiwetting nylon surfaces and as an additive to increase the hydrophobicity of carbon nanotube structures. This raw material is also employed in anti-reflective coatings, release coatings, soil-repellent coatings, and for self-cleaning purposes. Its low refractive index helps prevent light reflection from substrates, making it ideal for hydrophobic and oleophobic treatments on glass or fiber surfaces. |
| Chemical Formula | C13H13F17O3Si |
| Complexity | 693 |
| EC Number | 617-434-7 |
| Exact Mass | 568.036g/mol |
| Heavy Atom Count | 34 |
| MDL Number | MFCD07368748 |
| Monoisotopic Mass | 568.036g/mol |
| Packaging | Packed with 500 g, 1000 g plastic bottles, 200 L iron drum, or according to customer's requirement |
| Refractive Index | 1.33125 |
| Rotatable Bond Count | 12 |
| Specific Gravity | 1.5269~1.5469 |
| Topological Polar Surface Area | 27.7A^2 |
| WGK Germany | 3 |
※ Please kindly noted that this product is for research use only.