2,2,4,4,6,6-Hexamethylcyclotrisilazane
| Catalog Number | ACM1009934 |
|---|---|
| Product Name | 2,2,4,4,6,6-Hexamethylcyclotrisilazane |
| CAS | 1009-93-4 |
| Structure |  |
| Synonyms | Dimethylsilazane trimer |
| IUPAC Name | 2,2,4,4,6,6-Hexamethyl-1,3,5,2,4,6-triazatrisilinane |
| Molecular Weight | 219.51 |
| Molecular Formula | C6H21N3Si3 |
| Canonical SMILES | C[Si]1(N[Si](N[Si](N1)(C)C)(C)C)C |
| InChI | InChI=1S/C6H21N3Si3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h7-9H,1-6H3 |
| InChI Key | WGGNJZRNHUJNEM-UHFFFAOYSA-N |
| Boiling Point | 188 °C |
| Melting Point | -10 °C |
| Flash Point | 139 °F |
| Purity | 95%+ |
| Density | 0.92 g/mL at 25 °C (lit.) |
| Solubility | Decomposes in contact with water,Insoluble in water. |
| Appearance | Colorless liquid |
| Storage | Store under inert gas. |
| Complexity | 139 |
| Exact Mass | 219.10432729 |
| Heavy Atom Count | 12 |
| Monoisotopic Mass | 219.10432729 |
| Refractive Index | n20/D 1.445 (lit.) |
| Topological Polar Surface Area | 36.1 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
