2-(Trimethylsilyl)Phenyltrifluoromethanesulfonate

Catalog Number	ACM88284484
CAS Number	88284-48-4
Structure
Synonyms	(2-trimethylsilylphenyl) trifluoromethanesulfonate;
IUPAC Name	(2-trimethylsilylphenyl)trifluoromethanesulfonate
Molecular Weight	298.35 g/mol
Molecular Formula	C10H13F3O3SSi
Canonical SMILES	C[Si](C)(C)C1=CC=CC=C1OS(=O)(=O)C(F)(F)F
InChI Key	XBHPFCIWRHJDCP-UHFFFAOYSA-N
Boiling Point	70ºC2 mm Hg(lit.)
Flash Point	205 °F
Purity	95%+
Density	1.229 g/mL at 25ºC(lit.)
Appearance	Transparent liquid
Application	2-(Trimethylsilyl)Phenyltrifluoromethanesulfonate serves as a versatile reagent crucial in the field of aryne chemistry due to its ability to generate ortho-benzyne under mild conditions specifically with simple fluoride treatment at room temperature This compound plays a significant role in facilitating reactions involving polycyclic arenes heteroatom arylation heteroarenes and benzannulated heterocycles as well as carbon arylations making it invaluable in various synthetic applications
Exact Mass	298.03100
Packaging	10 g; 100 g;