3-[[Dimethyl(Vinyl)Silyl]Oxy]-1,1,5,5-Tetramethyl-3-Phenyl-1,5-Divinyltrisiloxane
| Catalog Number | ACM60111479-2 |
|---|---|
| Product Name | 3-[[Dimethyl(Vinyl)Silyl]Oxy]-1,1,5,5-Tetramethyl-3-Phenyl-1,5-Divinyltrisiloxane |
| CAS | 60111-47-9 |
| Structure |  |
| Synonyms | Tris[Dimethyl(Vinyl)Siloxy]Phenylsilane |
| IUPAC Name | tris[[ethenyl(dimethyl)silyl]oxy]-phenylsilane |
| Molecular Weight | 408.79 g/mol |
| Molecular Formula | C18H32O3Si4 |
| Canonical SMILES | C[Si](C)(C=C)O[Si](C1=CC=CC=C1)(O[Si](C)(C)C=C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C18H32O3Si4/c1-10-22(4,5)19-25(20-23(6,7)11-2,21-24(8,9)12-3)18-16-14-13-15-17-18/h10-17H,1-3H2,4-9H3 |
| InChI Key | XYVYGTWMOAIWOG-UHFFFAOYSA-N |
| Flash Point | 147 °C |
| Purity | >98% |
| Appearance | Colorless to Almost colorless clear liquid |
| Complexity | 428 |
| Exact Mass | 408.142851g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Monoisotopic Mass | 408.142851g/mol |
| Rotatable Bond Count | 10 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
