3-(Triethoxysilyl)propyl 2-Bromo-2-methylpropanoate
| Catalog Number | ACM880339311 |
|---|---|
| Product Name | 3-(Triethoxysilyl)propyl 2-Bromo-2-methylpropanoate |
| CAS | 880339-31-1 |
| Synonyms | 2-Bromo-2-methylpropanoic acid 3-(triethoxysilyl)propyl ester |
| IUPAC Name | 3-triethoxysilylpropyl 2-bromo-2-methylpropanoate |
| Molecular Weight | 371.34 |
| Molecular Formula | C13H27BrO5Si |
| Canonical SMILES | CCO[Si](CCCOC(=O)C(C)(C)Br)(OCC)OCC |
| InChI | InChI=1S/C13H27BrO5Si/c1-6-17-20(18-7-2,19-8-3)11-9-10-16-12(15)13(4,5)14/h6-11H2,1-5H3 |
| InChI Key | HRBDELVBHOGZRM-UHFFFAOYSA-N |
| Boiling Point | 130 °C at 1.5 mmHg |
| Flash Point | 163 °C |
| Purity | >93% (GC) |
| Density | 1.180±0.06 g/cm³ (Predicted) |
| Appearance | Colorless to light yellow clear liquid |
| Storage | Store under inert gas |
| Complexity | 269 |
| Exact Mass | 370.08111 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Hydrogen Bond Acceptor Count | 5 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 370.08111 |
| Rotatable Bond Count | 12 |
| Topological Polar Surface Area | 54 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
