Di-tert-butyldichlorosilane
| Catalog Number | ACM18395909 |
|---|---|
| Product Name | Di-tert-butyldichlorosilane |
| CAS | 18395-90-9 |
| Structure |  |
| Synonyms | Dichloro-di-tert-butylsilane; Dichlorobis(1,1-dimethylethyl)silane |
| IUPAC Name | ditert-butyl(dichloro)silane |
| Molecular Weight | 213.22 |
| Molecular Formula | C8H18Cl2Si |
| Canonical SMILES | CC(C)(C)[Si](C(C)(C)C)(Cl)Cl |
| InChI | InChI=1S/C8H18Cl2Si/c1-7(2,3)11(9,10)8(4,5)6/h1-6H3 |
| InChI Key | PDYPRPVKBUOHDH-UHFFFAOYSA-N |
| Boiling Point | 191 °C |
| Melting Point | -15 °C |
| Flash Point | 82 °C |
| Purity | >95% (GC) |
| Density | 1.009 g/mL at 25 °C (lit.) |
| Appearance | Colorless to light yellow clear liquid |
| Complexity | 123 |
| Exact Mass | 212.0554825 |
| Formal Charge | 0 |
| Heavy Atom Count | 11 |
| Hydrogen Bond Acceptor Count | 0 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 212.0554825 |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 0 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
