| Catalog Number |
ACM200068366-1 |
| CAS Number |
200068-36-6 |
| Structure |
 |
| Synonyms |
2,5-Dibromo-1,1,3,4-tetraphenylsilacyclopenta-2,4-diene |
| IUPAC Name |
2,5-dibromo-1,1,3,4-tetraphenylsilole |
| Molecular Weight |
544.36 |
| Molecular Formula |
C28H20Br2Si |
| Canonical SMILES |
C1=CC=C(C=C1)C2=C([Si](C(=C2C3=CC=CC=C3)Br)(C4=CC=CC=C4)C5=CC=CC=C5)Br |
| InChI |
InChI=1S/C28H20Br2Si/c29-27-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30)31(27,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChI Key |
MXGIPLZPCLLOTQ-UHFFFAOYSA-N |
| Melting Point |
170 °C |
| Purity |
>98.0%(GC) |
| Density |
Light Sensitive |
| Appearance |
Colorless to light yellow clear liquid |
| Storage |
Room temperature (Recommended in a cool and dark place, <15°C) |
| Complexity |
624 |
| Condition To Avoid |
Light sensitive |
| Exact Mass |
543.96805g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
31 |
| Monoisotopic Mass |
541.9701g/mol |
| Pubchem SID |
253661518 |
| Reaxys Registry Number |
7887549 |
| Rotatable Bond Count |
4 |
