Diphenylchlorosilane

Catalog Number	ACM1631830
CAS Number	1631-83-0
Structure
Synonyms	Diphenylchlorosilane, Chlorodiphenylsilane, Chloro(diphenyl)silane, Silane, chlorodiphenyl-, EINECS 216-634-8, Benzene, 1,1-(chlorosilylene)bis-, CID6327323, 1631-83-0
IUPAC Name	chloro(diphenyl)silicon
Molecular Weight	218.76 g/mol
Molecular Formula	C12H11ClSi
Canonical SMILES	C1=CC=C(C=C1)[Si](C2=CC=CC=C2)Cl
InChI Key	YCITZMJNBYYMJO-UHFFFAOYSA-N
Boiling Point	143 °C(10 torr)
Flash Point	86.1 °C
Purity	0.95
Density	1.11 g/mL
Appearance	Transparent liquid
Application	Diphenylchlorosilane serves as a versatile compound primarily utilized in various industrial and scientific applications due to its unique chemical properties It is integral in the synthesis of substituted alkyl- or aryldiphenylsilanes when it reacts with organolithium and Grignard reagents which are crucial intermediates in organic synthesis Additionally this compound finds significant usage in the medical field the electronics industry and the production of polymer materials Beyond these applications diphenylchlorosilane is also employed in the reduction of alcohols highlighting its role in facilitating various chemical transformations
EC Number	216-634-8
Exact Mass	218.03200
Packaging	10 g; 100 g;
Refractive Index	1.578(lit.)
WGK Germany	1