Diphenyldichlorosilane
| Catalog Number | ACM80104-1 |
|---|---|
| Product Name | Diphenyldichlorosilane |
| CAS | 80-10-4 |
| Structure |  |
| Synonyms | Dichlorodiphenylsilane |
| IUPAC Name | dichloro(diphenyl)silane |
| Molecular Weight | 253.20 |
| Molecular Formula | C12H10Cl2Si |
| Canonical SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(Cl)Cl |
| InChI | InChI=1S/C12H10Cl2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChI Key | OSXYHAQZDCICNX-UHFFFAOYSA-N |
| Boiling Point | 305 °C (lit.) |
| Melting Point | -22 °C |
| Flash Point | 316 °F |
| Purity | >98% (GC) |
| Density | 1.204 g/mL at 25 °C (lit.) |
| Appearance | Clear liquid with acrid odor of hydrogen chloride |
| Complexity | 174 |
| Exact Mass | 251.9928822 |
| Formal Charge | 0 |
| Heavy Atom Count | 15 |
| Hydrogen Bond Acceptor Count | 0 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 251.9928822 |
| Refractive Index | 1.5819 |
| Rotatable Bond Count | 2 |
| Topological Polar Surface Area | 0 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
![N-[N'-(2-Aminoethyl)aminoethyl]-3-aminopropyl-methyldimethoxysilane](https://resource.alfa-chemistry.com/structure/70240-34-5.gif)
