| Catalog Number |
ACM2627954 |
| CAS Number |
2627-95-4 |
| Structure |
 |
| Description |
Tetramethyldivinyl disiloxane is an organic compound with the chemical formula C8H18OSi2 and the appearance of a colorless transparent liquid. |
| Synonyms |
3,3,5,5-tetramethyl-3,5-disila-4-oxa-1,6-heptadiene;Divinyltetramethyldi;1,3-DIVINyltetraMETHYLDISILOXANE;Tetramethyldivinylsiloxane;Tetramethyl-1,3-divinyldisiloxane |
| IUPAC Name |
ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
| Molecular Weight |
186.4 g/mol |
| Molecular Formula |
C8H18OSi2 |
| Canonical SMILES |
C[Si](C)(C=C)O[Si](C)(C)C=C |
| InChI Key |
BITPLIXHRASDQB-UHFFFAOYSA-N |
| Boiling Point |
139 °C |
| Melting Point |
-99.7ºC |
| Flash Point |
24ºC |
| Purity |
95%+ |
| Density |
0.813 |
| Appearance |
Colorless liquid |
| Application |
Divinyltetramethyldisiloxane serves a crucial role as an additive in the manufacturing of various silicone-based products such as addition silicone rubber silicone gel liquid silicone vinyl silicone resin and vinyl silicone oil It is instrumental in enhancing the properties of these materials working as an intermediate that contributes to the effectiveness of their production processes Additionally Divinyltetramethyldisiloxane functions as a significant vinyl donor in cross-coupling and copolymerization reactions particularly involving aromatic ketones It is utilized as a diolefin ligand in complexes with d10-metal centers exhibiting a versatile ability to transition from π–π-bridging to chelating functions thereby forming stable compounds Furthermore it marks the beginning of the unsaturated polysiloxanes series with its complexes including those with Cu(I) being vital in creating thin copper films through thermal disproportionation |
| Storage |
Flammables area |
| EC Number |
220-099-6 |
| Exact Mass |
186.09000 |
| HS Code |
2934999090 |
| MDL Number |
MFCD00014933 |
| Packaging |
In 20 Kg, and 160 Kg drum |
| Refractive Index |
1.411-1.413 |
| RTECS |
JM9235250 |
| WGK Germany |
2 |
![Bis[3-(Triethoxysilyl)Propyl]Tetrasulfide](https://resource.alfa-chemistry.com/structure/40372-72-3.gif)
