Hexachlorodisilane
| Catalog Number | ACM13465775 |
|---|---|
| Product Name | Hexachlorodisilane |
| CAS | 13465-77-5 |
| Structure |  |
| Synonyms | 1,1,1,2,2,2-Hexachlorodisilane |
| IUPAC Name | Trichloro(trichlorosilyl)silane |
| Molecular Weight | 268.9 |
| Molecular Formula | Cl6Si2 |
| Canonical SMILES | [Si]([Si](Cl)(Cl)Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/Cl6Si2/c1-7(2,3)8(4,5)6 |
| InChI Key | LXEXBJXDGVGRAR-UHFFFAOYSA-N |
| Boiling Point | 144-145.5 °C |
| Melting Point | <0 °C |
| Flash Point | 78 °C |
| Purity | 95%+ |
| Density | 1.562 g/mL at 25 °C (lit.) |
| Appearance | Clear to straw-colored liquid |
| Storage | Store under inert gas |
| Complexity | 61.5 |
| Exact Mass | 267.764019 |
| Heavy Atom Count | 8 |
| Monoisotopic Mass | 267.764019 |
| Topological Polar Surface Area | 0 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
