N-[3-(Trimethoxysilyl)Propyl]Aniline
| Catalog Number | ACM3068766 |
|---|---|
| Product Name | N-[3-(Trimethoxysilyl)Propyl]Aniline |
| CAS | 3068-76-6 |
| Structure |  |
| Synonyms | N-Phenyl-3-Amipropyltrimethoxysilane |
| IUPAC Name | N-(3-trimethoxysilylpropyl)aniline |
| Molecular Weight | 255.39 |
| Molecular Formula | C12H21NO3Si |
| Canonical SMILES | CO[Si](CCCNC1=CC=CC=C1)(OC)OC |
| InChI Key | KBJFYLLAMSZSOG-UHFFFAOYSA-N |
| Boiling Point | 310 °C |
| Flash Point | 110 °C |
| Purity | 85% |
| Density | 1.07 g/mL |
| Appearance | Colorless transparent liquid |
| Application | It is mainly used as an adhesion promoter. |
| Storage | Keep away from heat and open flame |
| Exact Mass | 255.12900 |
| Refractive Index | 1.506 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
