| Catalog Number | ACM2943739-2 |
|---|---|
| CAS Number | 2943-73-9 |
| Synonyms | triethoxydecylsilane |
| IUPAC Name | decyl(triethoxy)silane |
| Molecular Weight | 304.54 g/mol |
| Molecular Formula | C16H36O3Si |
| Canonical SMILES | CCCCCCCCCC[Si](OCC)(OCC)OCC |
| InChI Key | BAAAEEDPKUHLID-UHFFFAOYSA-N |
| Boiling Point | 150/8 |
| Purity | 97% |
| Density | 0.8790 g/mL |
| Appearance | Transparent liquid |
| Application | N-Decyltriethoxysilane serves as a versatile coupling agent and chemical additive, finding applications in various industries. It is commonly used as an intermediate in OLED, pharmaceuticals, and cosmetics production. Additionally, it plays a crucial role in adhesives, coatings, crude oil, glass fibers, filler treatment, polymer modification, printing, elastomers, sealants, textiles, and thermoplastics, showcasing its wide range of uses. |
| Storage | Moisture sensitive, ambient temperatures |
| Chemical Formula | C16H36O3Si |
| EC Number | 220-940-7 |
| Exact Mass | 304.24300 |
| MDL Number | MFCD00069132 |
| Packaging | 10 g; 100 g |
| Reaxys Registry Number | 2413155 |
| Refractive Index | 1.4220 |
※ Please kindly noted that this product is for research use only.