Catalog Number | ACM2943739-2 |
---|---|
CAS Number | 2943-73-9 |
Structure | |
Synonyms | triethoxydecylsilane |
IUPAC Name | decyl(triethoxy)silane |
Molecular Weight | 304.54 g/mol |
Molecular Formula | C16H36O3Si |
Canonical SMILES | CCCCCCCCCC[Si](OCC)(OCC)OCC |
InChI Key | BAAAEEDPKUHLID-UHFFFAOYSA-N |
Boiling Point | 150/8 |
Purity | 97% |
Density | 0.8790 g/mL |
Appearance | Transparent liquid |
Application | N-Decyltriethoxysilane serves as a versatile coupling agent and chemical additive, finding applications in various industries. It is commonly used as an intermediate in OLED, pharmaceuticals, and cosmetics production. Additionally, it plays a crucial role in adhesives, coatings, crude oil, glass fibers, filler treatment, polymer modification, printing, elastomers, sealants, textiles, and thermoplastics, showcasing its wide range of uses. |
Storage | Moisture sensitive, ambient temperatures |
Chemical Formula | C16H36O3Si |
EC Number | 220-940-7 |
Exact Mass | 304.24300 |
MDL Number | MFCD00069132 |
Packaging | 10 g; 100 g |
Reaxys Registry Number | 2413155 |
Refractive Index | 1.4220 |
※ Please kindly noted that this product is for research use only.