| Catalog Number |
ACM2943751-2 |
| CAS Number |
2943-75-1 |
| Structure |
 |
| Description |
Colorless transparent liquid, soluble in a variety of organic solvents. |
| Synonyms |
n-Octyltriethoxysilane |
| IUPAC Name |
triethoxy(octyl)silane |
| Molecular Weight |
276.49 |
| Molecular Formula |
C14H32O3Si |
| Canonical SMILES |
CCCCCCCC[Si](OCC)(OCC)OCC |
| InChI |
InChI=1S/C14H32O3Si/c1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4/h5-14H2,1-4H3 |
| InChI Key |
MSRJTTSHWYDFIU-UHFFFAOYSA-N |
| Boiling Point |
98ºC |
| Flash Point |
100ºC |
| Density |
0.88 g/mL at 25 °C(lit.) |
| Solubility |
REACTS |
| Application |
n-Octyltriethoxysilane serves as a hydrophobization agent primarily used in limiting the coalescence of solid-stabilized emulsions This medium-chain alkylfunctional silane a clear colorless liquid soluble in non-polar organic solvents acts as an effective surface modifier to impart hydrophobic characteristics to materials such as concrete glass inorganic pigments and mineral fillers When mixed with suitable solvents n-Octyltriethoxysilane can be utilized to create water-repellent formulations These formulations when properly applied penetrate and react chemically with cementitious substrates to provide enduring water repellency while maintaining the original appearance of the treated surface By forming a self-assembled monolayer it offers a hydrophobic coating with reduced surface energy achieving a water contact angle typically between 150° and 170° |
| Storage |
Must be sealed and kept in cool and ventilated place, away from oxidizing agent, acids. |
| Complexity |
159 |
| EC Number |
220-941-2 |
| Exact Mass |
276.212071g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
18 |
| Monoisotopic Mass |
276.212071g/mol |
| Packaging |
Packed in 25kg and 200kg PVF steel drum or plastic drum. |
| Refractive Index |
1.416-1.418 |
| Rotatable Bond Count |
13 |
