Trichloro(1H,1H,2H,2H-perfluoroctyl)silane
| Catalog Number | ACM78560459-5 |
|---|---|
| Product Name | Trichloro(1H,1H,2H,2H-perfluoroctyl)silane |
| CAS | 78560-45-9 |
| Structure |  |
| Synonyms | 1H,1H,2H,2H-Perfluorooctyltrichlorosilane |
| IUPAC Name | Trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| Molecular Weight | 481.5 |
| Molecular Formula | C8H4Cl3F13Si |
| Canonical SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | InChI=1S/C8H4Cl3F13Si/c9-25(10,11)2-1-3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24/h1-2H2 |
| InChI Key | PISDRBMXQBSCIP-UHFFFAOYSA-N |
| Boiling Point | 192 °C |
| Melting Point | -32 °C |
| Flash Point | 189 °F |
| Purity | 95%+ |
| Density | 1.3 g/mL at 25 °C (lit.) |
| Solubility | Miscible with tetrahydrofuran, tetrhydropyran, toluene and other organic solvents |
| Storage | Moisture Sensitive |
| Complexity | 481 |
| Exact Mass | 479.894026 |
| Heavy Atom Count | 25 |
| Monoisotopic Mass | 479.894026 |
| Refractive Index | 1.352 |
| Topological Polar Surface Area | 0 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
