Triethoxy(3-Glycidyloxypropyl)Silane
| Catalog Number | ACM2602348-1 |
|---|---|
| Product Name | Triethoxy(3-Glycidyloxypropyl)Silane |
| CAS | 2602-34-8 |
| Structure |  |
| Description | Liquid |
| Synonyms | Glycidyl 3-Triethoxysilylpropyl Ether |
| IUPAC Name | triethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| Molecular Weight | 278.42 |
| Molecular Formula | C12H26O5Si |
| Canonical SMILES | CCO[Si](CCCOCC1CO1)(OCC)OCC |
| InChI | InChI=1S/C12H26O5Si/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-10-12-11-14-12/h12H,4-11H2,1-3H3 |
| InChI Key | JXUKBNICSRJFAP-UHFFFAOYSA-N |
| Boiling Point | 135 °C (2 mmHg) |
| Flash Point | 118 °C |
| Purity | >96% |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Complexity | 198 |
| Exact Mass | 278.15495g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Monoisotopic Mass | 278.15495g/mol |
| Rotatable Bond Count | 12 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
