Triethoxy(Pentafluorophenyl)Silane
| Catalog Number | ACM20083345-2 |
|---|---|
| Product Name | Triethoxy(Pentafluorophenyl)Silane |
| CAS | 20083-34-5 |
| Structure |  |
| IUPAC Name | triethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| Molecular Weight | 330.33 |
| Molecular Formula | C12H15F5O3Si |
| Canonical SMILES | CCO[Si](C1=C(C(=C(C(=C1F)F)F)F)F)(OCC)OCC |
| InChI | InChI=1S/C12H15F5O3Si/c1-4-18-21(19-5-2,20-6-3)12-10(16)8(14)7(13)9(15)11(12)17/h4-6H2,1-3H3 |
| InChI Key | QALDFNLNVLQDSP-UHFFFAOYSA-N |
| Boiling Point | 238 °C |
| Flash Point | 104 °C |
| Purity | >95% |
| Appearance | Colorless to almost colorless clear liquid |
| Storage | Store under inert gas |
| Complexity | 292 |
| Exact Mass | 330.071062g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Monoisotopic Mass | 330.071062g/mol |
| Rotatable Bond Count | 7 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
